C5H10O — CID 7869082
[(1S,2S)-2-methylcyclopropyl]methanol (PubChem CID 7869082) has the molecular formula C5H10O and a molecular weight of 86.13 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclopropyl]methanol.
| Compound Name | [(1S,2S)-2-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 7869082 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | [(1S,2S)-2-methylcyclopropyl]methanol |
| SMILES | C[C@H]1C[C@@H]1CO |
| InChI | InChI=1S/C5H10O/c1-4-2-5(4)3-6/h4-6H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | SHEINYPABNPRPM-CRCLSJGQSA-N |
| XLogP | 0.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |