C9H18O3S — CID 99111079
[(1S,2S,4R)-4-ethylsulfonyl-2-methylcyclopentyl]methanol (PubChem CID 99111079) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is [(1S,2S,4R)-4-ethylsulfonyl-2-methylcyclopentyl]methanol.
| Compound Name | [(1S,2S,4R)-4-ethylsulfonyl-2-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 99111079 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | [(1S,2S,4R)-4-ethylsulfonyl-2-methylcyclopentyl]methanol |
| SMILES | CCS(=O)(=O)[C@H]1C[C@H](CO)[C@@H](C)C1 |
| InChI | InChI=1S/C9H18O3S/c1-3-13(11,12)9-4-7(2)8(5-9)6-10/h7-10H,3-6H2,1-2H3/t7-,8+,9+/m0/s1 |
| InChIKey | JFZOIXHEYHHHHN-DJLDLDEBSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |