About (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane
(1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane (PubChem CID 160569820) has the molecular formula C8H20O3S3
and a molecular weight of 260.45 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane.
Molecular Properties
| Compound Name | (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane |
| PubChem CID | 160569820 |
| Molecular Formula | C8H20O3S3 |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane |
| SMILES | CS(=O)(=O)C[C@@H](O)C1CCCC1.S.S |
| InChI | InChI=1S/C8H16O3S.2H2S/c1-12(10,11)6-8(9)7-4-2-3-5-7;;/h7-9H,2-6H2,1H3;2*1H2/t8-;;/m1../s1 |
| InChIKey | RAJZTGQIFMTGFI-YCBDHFTFSA-N |
| XLogP | 0.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane?
The IUPAC name of (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane (CID 160569820) is (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane.
What is the SMILES notation for (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane?
The canonical SMILES for (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane is CS(=O)(=O)C[C@@H](O)C1CCCC1.S.S.
What is the InChIKey of (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane?
The InChIKey is RAJZTGQIFMTGFI-YCBDHFTFSA-N. The full InChI is InChI=1S/C8H16O3S.2H2S/c1-12(10,11)6-8(9)7-4-2-3-5-7;;/h7-9H,2-6H2,1H3;2*1H2/t8-;;/m1../s1.
What are the key properties of (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane?
(1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane has a molecular weight of 260.45 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclopentyl-2-methylsulfonylethanol;sulfane is sourced from PubChem (CID 160569820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).