C11H20F2O3S — CID 114215860
1-(3,3-difluorocyclopentyl)-4-ethylsulfonylbutan-1-ol (PubChem CID 114215860) has the molecular formula C11H20F2O3S and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(3,3-difluorocyclopentyl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 114215860 |
| Molecular Formula | C11H20F2O3S |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H20F2O3S/c1-2-17(15,16)7-3-4-10(14)9-5-6-11(12,13)8-9/h9-10,14H,2-8H2,1H3 |
| InChIKey | ZRVRYVLTZZKERQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |