About (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol
(2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol (PubChem CID 161050588) has the molecular formula C12H23F3O3S
and a molecular weight of 304.37 g/mol. Its IUPAC name is (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol.
Molecular Properties
| Compound Name | (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol |
| PubChem CID | 161050588 |
| Molecular Formula | C12H23F3O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol |
| SMILES | C[C@@H](O)CCCCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H23F3O3S/c1-11(16)7-4-2-3-5-9-19(17,18)10-6-8-12(13,14)15/h11,16H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | UCBXZFPFJNAHFD-LLVKDONJSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol?
The IUPAC name of (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol (CID 161050588) is (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol.
What is the SMILES notation for (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol?
The canonical SMILES for (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol is C[C@@H](O)CCCCCCS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol?
The InChIKey is UCBXZFPFJNAHFD-LLVKDONJSA-N. The full InChI is InChI=1S/C12H23F3O3S/c1-11(16)7-4-2-3-5-9-19(17,18)10-6-8-12(13,14)15/h11,16H,2-10H2,1H3/t11-/m1/s1.
What are the key properties of (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol?
(2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol has a molecular weight of 304.37 g/mol, XLogP of 3.08, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol is sourced from PubChem (CID 161050588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).