C12H23F3O3S — CID 161050588
(2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol (PubChem CID 161050588) has the molecular formula C12H23F3O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol.
| Compound Name | (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol |
|---|---|
| PubChem CID | 161050588 |
| Molecular Formula | C12H23F3O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R)-8-(4,4,4-trifluorobutylsulfonyl)octan-2-ol |
| SMILES | C[C@@H](O)CCCCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H23F3O3S/c1-11(16)7-4-2-3-5-9-19(17,18)10-6-8-12(13,14)15/h11,16H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | UCBXZFPFJNAHFD-LLVKDONJSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|