C9H16 — CID 59524466
(1S)-1-methyl-2-[[(2R)-2-methylcyclopropyl]methyl]cyclopropane (PubChem CID 59524466) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (1S)-1-methyl-2-[[(2R)-2-methylcyclopropyl]methyl]cyclopropane.
| Compound Name | (1S)-1-methyl-2-[[(2R)-2-methylcyclopropyl]methyl]cyclopropane |
|---|---|
| PubChem CID | 59524466 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (1S)-1-methyl-2-[[(2R)-2-methylcyclopropyl]methyl]cyclopropane |
| SMILES | C[C@@H]1CC1CC1C[C@@H]1C |
| InChI | InChI=1S/C9H16/c1-6-3-8(6)5-9-4-7(9)2/h6-9H,3-5H2,1-2H3/t6-,7+,8?,9? |
| InChIKey | WWXGBMZROYHRPZ-QPIHLSAKSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |