C8H16O4 — CID 159801457
(1R,2S,3R,4R,6S)-4-(hydroxymethyl)-6-methylcyclohexane-1,2,3-triol (PubChem CID 159801457) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1R,2S,3R,4R,6S)-4-(hydroxymethyl)-6-methylcyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6S)-4-(hydroxymethyl)-6-methylcyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 159801457 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (1R,2S,3R,4R,6S)-4-(hydroxymethyl)-6-methylcyclohexane-1,2,3-triol |
| SMILES | C[C@H]1C[C@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16O4/c1-4-2-5(3-9)7(11)8(12)6(4)10/h4-12H,2-3H2,1H3/t4-,5+,6+,7+,8-/m0/s1 |
| InChIKey | NJVPONGVWKQTIO-WCMLQCRESA-N |
| XLogP | -1.28 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |