C7H16NO4+ — CID 40566342
[(1S,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]azanium (PubChem CID 40566342) has the molecular formula C7H16NO4+ and a molecular weight of 178.21 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]azanium.
| Compound Name | [(1S,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]azanium |
|---|---|
| PubChem CID | 40566342 |
| Molecular Formula | C7H16NO4+ |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | [(1S,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]azanium |
| SMILES | [NH3+][C@H]1C[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15NO4/c8-4-1-3(2-9)5(10)7(12)6(4)11/h3-7,9-12H,1-2,8H2/p+1/t3-,4+,5-,6+,7+/m1/s1 |
| InChIKey | GSQYAWMREAXBHF-UOYQFSTFSA-O |
| XLogP | -3.31 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |