C11H20O2 — CID 129413335
[(2S,3S,3aR,4R,7aS)-2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol (PubChem CID 129413335) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is [(2S,3S,3aR,4R,7aS)-2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol.
| Compound Name | [(2S,3S,3aR,4R,7aS)-2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol |
|---|---|
| PubChem CID | 129413335 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | [(2S,3S,3aR,4R,7aS)-2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol |
| SMILES | C[C@H]1[C@H]2[C@H](CO)CCC[C@@H]2O[C@H]1C |
| InChI | InChI=1S/C11H20O2/c1-7-8(2)13-10-5-3-4-9(6-12)11(7)10/h7-12H,3-6H2,1-2H3/t7-,8+,9+,10+,11+/m1/s1 |
| InChIKey | HOJREIXXTBXSDL-NMUGVGKYSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |