C10H17NO2 — CID 11052296
(1S,4S,5S,7R,11R)-3,5-dimethyl-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane (PubChem CID 11052296) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (1S,4S,5S,7R,11R)-3,5-dimethyl-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane.
| Compound Name | (1S,4S,5S,7R,11R)-3,5-dimethyl-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 11052296 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (1S,4S,5S,7R,11R)-3,5-dimethyl-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane |
| SMILES | C[C@@H]1O[C@@H]2CCC[C@@H]3ON(C)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C10H17NO2/c1-6-10-9-7(12-6)4-3-5-8(9)13-11(10)2/h6-10H,3-5H2,1-2H3/t6-,7+,8-,9+,10+/m0/s1 |
| InChIKey | CJSHWCJPRVDIET-SQXHDICFSA-N |
| XLogP | 1.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |