C11H22NO4P — CID 101429409
(3R,3aS,6aR)-3-diethoxyphosphoryl-2-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole (PubChem CID 101429409) has the molecular formula C11H22NO4P and a molecular weight of 263.27 g/mol. Its IUPAC name is (3R,3aS,6aR)-3-diethoxyphosphoryl-2-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole.
| Compound Name | (3R,3aS,6aR)-3-diethoxyphosphoryl-2-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole |
|---|---|
| PubChem CID | 101429409 |
| Molecular Formula | C11H22NO4P |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (3R,3aS,6aR)-3-diethoxyphosphoryl-2-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole |
| SMILES | CCOP(=O)(OCC)[C@@H]1[C@H]2CCC[C@H]2ON1C |
| InChI | InChI=1S/C11H22NO4P/c1-4-14-17(13,15-5-2)11-9-7-6-8-10(9)16-12(11)3/h9-11H,4-8H2,1-3H3/t9-,10+,11+/m0/s1 |
| InChIKey | LHEUEVZDIGLABS-HBNTYKKESA-N |
| XLogP | 2.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|