C7H15O4P — CID 163038717
(2S,3R)-2-diethoxyphosphoryl-3-methyloxirane (PubChem CID 163038717) has the molecular formula C7H15O4P and a molecular weight of 194.17 g/mol. Its IUPAC name is (2S,3R)-2-diethoxyphosphoryl-3-methyloxirane.
| Compound Name | (2S,3R)-2-diethoxyphosphoryl-3-methyloxirane |
|---|---|
| PubChem CID | 163038717 |
| Molecular Formula | C7H15O4P |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (2S,3R)-2-diethoxyphosphoryl-3-methyloxirane |
| SMILES | CCOP(=O)(OCC)[C@@H]1O[C@@H]1C |
| InChI | InChI=1S/C7H15O4P/c1-4-9-12(8,10-5-2)7-6(3)11-7/h6-7H,4-5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | GNYJAXDLNDFBSU-RQJHMYQMSA-N |
| XLogP | 2.00 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|