C8H16FO5P — CID 89042432
2-[diethoxyphosphoryl(fluoro)methyl]-4-methyl-1,3-dioxetane (PubChem CID 89042432) has the molecular formula C8H16FO5P and a molecular weight of 242.18 g/mol. Its IUPAC name is 2-[diethoxyphosphoryl(fluoro)methyl]-4-methyl-1,3-dioxetane.
| Compound Name | 2-[diethoxyphosphoryl(fluoro)methyl]-4-methyl-1,3-dioxetane |
|---|---|
| PubChem CID | 89042432 |
| Molecular Formula | C8H16FO5P |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-[diethoxyphosphoryl(fluoro)methyl]-4-methyl-1,3-dioxetane |
| SMILES | CCOP(=O)(OCC)C(F)C1OC(C)O1 |
| InChI | InChI=1S/C8H16FO5P/c1-4-11-15(10,12-5-2)7(9)8-13-6(3)14-8/h6-8H,4-5H2,1-3H3 |
| InChIKey | RNUQJJCYBZVDPU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|