C11H22FO8P — CID 102370910
(2R,3R,4S,5S,6R)-6-[(2R)-2-diethoxyphosphoryl-2-fluoroethyl]oxane-2,3,4,5-tetrol (PubChem CID 102370910) has the molecular formula C11H22FO8P and a molecular weight of 332.26 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-[(2R)-2-diethoxyphosphoryl-2-fluoroethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-[(2R)-2-diethoxyphosphoryl-2-fluoroethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 102370910 |
| Molecular Formula | C11H22FO8P |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[(2R)-2-diethoxyphosphoryl-2-fluoroethyl]oxane-2,3,4,5-tetrol |
| SMILES | CCOP(=O)(OCC)[C@@H](F)C[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H22FO8P/c1-3-18-21(17,19-4-2)7(12)5-6-8(13)9(14)10(15)11(16)20-6/h6-11,13-16H,3-5H2,1-2H3/t6-,7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | BCCACKSIFQNABG-MPVQUNCYSA-N |
| XLogP | -0.26 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|