C10H22NO6PS — CID 166437541
(4S,5R)-5-diethoxyphosphoryl-4-(2-methylpropyl)oxathiazolidine 2,2-dioxide (PubChem CID 166437541) has the molecular formula C10H22NO6PS and a molecular weight of 315.33 g/mol. Its IUPAC name is (4S,5R)-5-diethoxyphosphoryl-4-(2-methylpropyl)oxathiazolidine 2,2-dioxide.
| Compound Name | (4S,5R)-5-diethoxyphosphoryl-4-(2-methylpropyl)oxathiazolidine 2,2-dioxide |
|---|---|
| PubChem CID | 166437541 |
| Molecular Formula | C10H22NO6PS |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (4S,5R)-5-diethoxyphosphoryl-4-(2-methylpropyl)oxathiazolidine 2,2-dioxide |
| SMILES | CCOP(=O)(OCC)[C@H]1OS(=O)(=O)N[C@H]1CC(C)C |
| InChI | InChI=1S/C10H22NO6PS/c1-5-15-18(12,16-6-2)10-9(7-8(3)4)11-19(13,14)17-10/h8-11H,5-7H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | STYGLLWDNFZQAY-VHSXEESVSA-N |
| XLogP | 1.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|