C14H29O3P — CID 10778844
2-diethoxyphosphoryl-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 10778844) has the molecular formula C14H29O3P and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | 2-diethoxyphosphoryl-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 10778844 |
| Molecular Formula | C14H29O3P |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-diethoxyphosphoryl-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CCOP(=O)(OCC)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C14H29O3P/c1-6-16-18(15,17-7-2)14-10-12(5)8-9-13(14)11(3)4/h11-14H,6-10H2,1-5H3 |
| InChIKey | TYBNWQAGQWPWEA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|