C21H33O4P — CID 174245778
2,3-dihydro-1H-inden-2-yl ethyl [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] phosphate (PubChem CID 174245778) has the molecular formula C21H33O4P and a molecular weight of 380.47 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl ethyl [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] phosphate.
| Compound Name | 2,3-dihydro-1H-inden-2-yl ethyl [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] phosphate |
|---|---|
| PubChem CID | 174245778 |
| Molecular Formula | C21H33O4P |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl ethyl [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] phosphate |
| SMILES | CCOP(=O)(OC1Cc2ccccc2C1)OC1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C21H33O4P/c1-5-23-26(22,24-19-13-17-8-6-7-9-18(17)14-19)25-21-12-16(4)10-11-20(21)15(2)3/h6-9,15-16,19-21H,5,10-14H2,1-4H3/t16-,20+,21?,26?/m0/s1 |
| InChIKey | YERHJRROAAZFAU-WQOJKFBHSA-N |
| XLogP | 5.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|