C18H29OP — CID 626091
[methyl-(5-methyl-2-propan-2-ylcyclohexyl)phosphoryl]methylbenzene (PubChem CID 626091) has the molecular formula C18H29OP and a molecular weight of 292.40 g/mol. Its IUPAC name is [methyl-(5-methyl-2-propan-2-ylcyclohexyl)phosphoryl]methylbenzene.
| Compound Name | [methyl-(5-methyl-2-propan-2-ylcyclohexyl)phosphoryl]methylbenzene |
|---|---|
| PubChem CID | 626091 |
| Molecular Formula | C18H29OP |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [methyl-(5-methyl-2-propan-2-ylcyclohexyl)phosphoryl]methylbenzene |
| SMILES | CC1CCC(C(C)C)C(P(C)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H29OP/c1-14(2)17-11-10-15(3)12-18(17)20(4,19)13-16-8-6-5-7-9-16/h5-9,14-15,17-18H,10-13H2,1-4H3 |
| InChIKey | QXZSESHHUPSIJW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|