C13H19O4P — CID 101084246
(2S,3S)-2-diethoxyphosphoryl-3-(3-methylphenyl)oxirane (PubChem CID 101084246) has the molecular formula C13H19O4P and a molecular weight of 270.26 g/mol. Its IUPAC name is (2S,3S)-2-diethoxyphosphoryl-3-(3-methylphenyl)oxirane.
| Compound Name | (2S,3S)-2-diethoxyphosphoryl-3-(3-methylphenyl)oxirane |
|---|---|
| PubChem CID | 101084246 |
| Molecular Formula | C13H19O4P |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2S,3S)-2-diethoxyphosphoryl-3-(3-methylphenyl)oxirane |
| SMILES | CCOP(=O)(OCC)[C@@H]1O[C@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C13H19O4P/c1-4-15-18(14,16-5-2)13-12(17-13)11-8-6-7-10(3)9-11/h6-9,12-13H,4-5H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | FWQXYIQOVHEIBJ-STQMWFEESA-N |
| XLogP | 3.66 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|