C10H12O2 — CID 54327905
[(2R,3R)-3-(3-methylphenyl)oxiran-2-yl]methanol (PubChem CID 54327905) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is [(2R,3R)-3-(3-methylphenyl)oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-(3-methylphenyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 54327905 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | [(2R,3R)-3-(3-methylphenyl)oxiran-2-yl]methanol |
| SMILES | Cc1cccc([C@H]2O[C@@H]2CO)c1 |
| InChI | InChI=1S/C10H12O2/c1-7-3-2-4-8(5-7)10-9(6-11)12-10/h2-5,9-11H,6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | SWGFEEOVOVYCSV-NXEZZACHSA-N |
| XLogP | 1.43 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|