C9H9FO2 — CID 119084986
[(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]methanol (PubChem CID 119084986) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is [(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 119084986 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | [(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]methanol |
| SMILES | OC[C@@H]1O[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FO2/c10-7-3-1-6(2-4-7)9-8(5-11)12-9/h1-4,8-9,11H,5H2/t8-,9+/m0/s1 |
| InChIKey | LTNNWDJMVWKQNO-DTWKUNHWSA-N |
| XLogP | 1.26 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|