C10H9F3O2 — CID 22840453
[(2S,3S)-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanol (PubChem CID 22840453) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is [(2S,3S)-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 22840453 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | [(2S,3S)-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanol |
| SMILES | OC[C@@H]1O[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3O2/c11-10(12,13)7-3-1-2-6(4-7)9-8(5-14)15-9/h1-4,8-9,14H,5H2/t8-,9-/m0/s1 |
| InChIKey | VEVQFFVTOWDEGH-IUCAKERBSA-N |
| XLogP | 2.14 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|