C11H7Cl2F3O2 — CID 122628118
2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 122628118) has the molecular formula C11H7Cl2F3O2 and a molecular weight of 299.08 g/mol. Its IUPAC name is 2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 122628118 |
| Molecular Formula | C11H7Cl2F3O2 |
| Molecular Weight | 299.08 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2,2-dichloro-3-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1C(c2cccc(C(F)(F)F)c2)C1(Cl)Cl |
| InChI | InChI=1S/C11H7Cl2F3O2/c12-10(13)7(8(10)9(17)18)5-2-1-3-6(4-5)11(14,15)16/h1-4,7-8H,(H,17,18) |
| InChIKey | VMLIAYNBHIGTMT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.08 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|