C11H5Cl3F4O2 — CID 134418440
2,2-dichloro-3-[4-chloro-3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 134418440) has the molecular formula C11H5Cl3F4O2 and a molecular weight of 351.51 g/mol. Its IUPAC name is 2,2-dichloro-3-[4-chloro-3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dichloro-3-[4-chloro-3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 134418440 |
| Molecular Formula | C11H5Cl3F4O2 |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 2,2-dichloro-3-[4-chloro-3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1C(c2cc(F)c(Cl)c(C(F)(F)F)c2)C1(Cl)Cl |
| InChI | InChI=1S/C11H5Cl3F4O2/c12-8-4(11(16,17)18)1-3(2-5(8)15)6-7(9(19)20)10(6,13)14/h1-2,6-7H,(H,19,20) |
| InChIKey | AUWFYXYCKIBUNM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|