C10H4Cl5FO — CID 150564885
2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)cyclopropane-1-carbonyl chloride (PubChem CID 150564885) has the molecular formula C10H4Cl5FO and a molecular weight of 336.40 g/mol. Its IUPAC name is 2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)cyclopropane-1-carbonyl chloride.
| Compound Name | 2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 150564885 |
| Molecular Formula | C10H4Cl5FO |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 333.87 |
| IUPAC Name | 2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)cyclopropane-1-carbonyl chloride |
| SMILES | O=C(Cl)C1C(c2cc(Cl)c(F)c(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C10H4Cl5FO/c11-4-1-3(2-5(12)8(4)16)6-7(9(13)17)10(6,14)15/h1-2,6-7H |
| InChIKey | IKPWKVFYNPZQSP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|