C10H6Cl3FO — CID 122615213
cis-(1S,3S)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropane-1-carbaldehyde (PubChem CID 122615213) has the molecular formula C10H6Cl3FO and a molecular weight of 267.51 g/mol. Its IUPAC name is cis-(1S,3S)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,3S)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 122615213 |
| Molecular Formula | C10H6Cl3FO |
| Molecular Weight | 267.51 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | cis-(1S,3S)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropane-1-carbaldehyde |
| SMILES | O=C[C@@H]1[C@@H](c2ccc(F)c(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C10H6Cl3FO/c11-7-3-5(1-2-8(7)14)9-6(4-15)10(9,12)13/h1-4,6,9H/t6-,9-/m1/s1 |
| InChIKey | JFGPRMYSURXERZ-HZGVNTEJSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|