C10H6Cl4O — CID 122615653
2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carbaldehyde (PubChem CID 122615653) has the molecular formula C10H6Cl4O and a molecular weight of 283.97 g/mol. Its IUPAC name is 2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carbaldehyde.
| Compound Name | 2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 122615653 |
| Molecular Formula | C10H6Cl4O |
| Molecular Weight | 283.97 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carbaldehyde |
| SMILES | O=CC1C(c2ccc(Cl)c(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C10H6Cl4O/c11-7-2-1-5(3-8(7)12)9-6(4-15)10(9,13)14/h1-4,6,9H |
| InChIKey | IAFMGVXZSOCQSP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|