C20H15Cl5N2O3 — CID 122621073
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-prop-2-enoxybenzamide (PubChem CID 122621073) has the molecular formula C20H15Cl5N2O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-prop-2-enoxybenzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 122621073 |
| Molecular Formula | C20H15Cl5N2O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-prop-2-enoxybenzamide |
| SMILES | C=CCONC(=O)c1cc(NC(=O)[C@H]2[C@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C20H15Cl5N2O3/c1-2-7-30-27-18(28)12-9-11(4-6-13(12)21)26-19(29)17-16(20(17,24)25)10-3-5-14(22)15(23)8-10/h2-6,8-9,16-17H,1,7H2,(H,26,29)(H,27,28)/t16-,17+/m0/s1 |
| InChIKey | MOUMGSPIWUOROF-DLBZAZTESA-N |
| XLogP | 6.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|