C23H14Cl5F2N3O2 — CID 134418215
N-(4-amino-3,5-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 134418215) has the molecular formula C23H14Cl5F2N3O2 and a molecular weight of 579.65 g/mol. Its IUPAC name is N-(4-amino-3,5-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(4-amino-3,5-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 134418215 |
| Molecular Formula | C23H14Cl5F2N3O2 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 576.95 |
| IUPAC Name | N-(4-amino-3,5-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1c(F)cc(NC(=O)c2cc(NC(=O)C3C(c4ccc(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)cc1F |
| InChI | InChI=1S/C23H14Cl5F2N3O2/c24-13-4-2-10(6-12(13)21(34)33-11-7-16(29)20(31)17(30)8-11)32-22(35)19-18(23(19,27)28)9-1-3-14(25)15(26)5-9/h1-8,18-19H,31H2,(H,32,35)(H,33,34) |
| InChIKey | HRPBDDLFUWKNCD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|