C23H15Cl5FN3O2 — CID 122618024
N-(5-amino-2-fluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122618024) has the molecular formula C23H15Cl5FN3O2 and a molecular weight of 561.66 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122618024 |
| Molecular Formula | C23H15Cl5FN3O2 |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 558.96 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1ccc(F)c(NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4ccc(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C23H15Cl5FN3O2/c24-14-5-3-12(9-13(14)21(33)32-18-8-11(30)2-6-17(18)29)31-22(34)20-19(23(20,27)28)10-1-4-15(25)16(26)7-10/h1-9,19-20H,30H2,(H,31,34)(H,32,33)/t19-,20+/m0/s1 |
| InChIKey | HIGWKCDWZIOGOR-VQTJNVASSA-N |
| XLogP | 7.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|