C24H15Cl3F5N3O2 — CID 139571364
N-(4-amino-2-fluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide (PubChem CID 139571364) has the molecular formula C24H15Cl3F5N3O2 and a molecular weight of 578.75 g/mol. Its IUPAC name is N-(4-amino-2-fluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(4-amino-2-fluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 139571364 |
| Molecular Formula | C24H15Cl3F5N3O2 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | N-(4-amino-2-fluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1ccc(NC(=O)c2cc(NC(=O)C3[C@H](c4ccc(F)c(C(F)(F)F)c4)C3(Cl)Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C24H15Cl3F5N3O2/c25-15-4-3-12(9-13(15)21(36)35-18-6-2-11(33)8-17(18)29)34-22(37)20-19(23(20,26)27)10-1-5-16(28)14(7-10)24(30,31)32/h1-9,19-20H,33H2,(H,34,37)(H,35,36)/t19-,20?/m0/s1 |
| InChIKey | DPUOIHZVTDAFQX-XJDOXCRVSA-N |
| XLogP | 7.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|