C27H16Cl3F8N3O3 — CID 140859879
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[3-(2,2-difluoropropanoylamino)-2,4-difluorophenyl]benzamide (PubChem CID 140859879) has the molecular formula C27H16Cl3F8N3O3 and a molecular weight of 688.79 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[3-(2,2-difluoropropanoylamino)-2,4-difluorophenyl]benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[3-(2,2-difluoropropanoylamino)-2,4-difluorophenyl]benzamide |
|---|---|
| PubChem CID | 140859879 |
| Molecular Formula | C27H16Cl3F8N3O3 |
| Molecular Weight | 688.79 g/mol |
| Exact Mass | 687.01 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]-N-[3-(2,2-difluoropropanoylamino)-2,4-difluorophenyl]benzamide |
| SMILES | CC(F)(F)C(=O)Nc1c(F)ccc(NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4ccc(F)c(C(F)(F)F)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C27H16Cl3F8N3O3/c1-25(34,35)24(44)41-21-16(32)6-7-17(20(21)33)40-22(42)12-9-11(3-4-14(12)28)39-23(43)19-18(26(19,29)30)10-2-5-15(31)13(8-10)27(36,37)38/h2-9,18-19H,1H3,(H,39,43)(H,40,42)(H,41,44)/t18-,19+/m0/s1 |
| InChIKey | WJYIBYWCVOJHNY-RBUKOAKNSA-N |
| XLogP | 8.15 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.79 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|