C25H13Cl4F6N3O3 — CID 140860003
5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide (PubChem CID 140860003) has the molecular formula C25H13Cl4F6N3O3 and a molecular weight of 659.20 g/mol. Its IUPAC name is 5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide.
| Compound Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 140860003 |
| Molecular Formula | C25H13Cl4F6N3O3 |
| Molecular Weight | 659.20 g/mol |
| Exact Mass | 656.96 |
| IUPAC Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(F)c(NC(=O)C(F)(F)F)c1F)c1cc(NC(=O)[C@H]2[C@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1F |
| InChI | InChI=1S/C25H13Cl4F6N3O3/c26-12-3-1-9(7-13(12)27)17-18(24(17,28)29)22(40)36-10-2-4-14(30)11(8-10)21(39)37-16-6-5-15(31)20(19(16)32)38-23(41)25(33,34)35/h1-8,17-18H,(H,36,40)(H,37,39)(H,38,41)/t17-,18+/m0/s1 |
| InChIKey | COZMRCGRAWQDMY-ZWKOTPCHSA-N |
| XLogP | 7.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.20 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|