C25H12Cl5F6N3O3 — CID 140860336
5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,6-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide (PubChem CID 140860336) has the molecular formula C25H12Cl5F6N3O3 and a molecular weight of 693.64 g/mol. Its IUPAC name is 5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,6-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide.
| Compound Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,6-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 140860336 |
| Molecular Formula | C25H12Cl5F6N3O3 |
| Molecular Weight | 693.64 g/mol |
| Exact Mass | 690.92 |
| IUPAC Name | 5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,6-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1c(F)ccc(NC(=O)C(F)(F)F)c1F)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1F |
| InChI | InChI=1S/C25H12Cl5F6N3O3/c26-11-5-8(6-12(27)18(11)28)16-17(24(16,29)30)22(41)37-9-1-2-13(31)10(7-9)21(40)39-20-14(32)3-4-15(19(20)33)38-23(42)25(34,35)36/h1-7,16-17H,(H,37,41)(H,38,42)(H,39,40)/t16-,17+/m0/s1 |
| InChIKey | VUQQZMHDFOWRIZ-DLBZAZTESA-N |
| XLogP | 8.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.64 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|