C23H13Cl6F2N3O2 — CID 138653301
N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 138653301) has the molecular formula C23H13Cl6F2N3O2 and a molecular weight of 614.09 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 138653301 |
| Molecular Formula | C23H13Cl6F2N3O2 |
| Molecular Weight | 614.09 g/mol |
| Exact Mass | 610.91 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2cc(NC(=O)C3[C@H](c4cc(Cl)c(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C23H13Cl6F2N3O2/c24-11-2-1-9(7-10(11)21(35)34-15-4-3-14(30)20(32)19(15)31)33-22(36)17-16(23(17,28)29)8-5-12(25)18(27)13(26)6-8/h1-7,16-17H,32H2,(H,33,36)(H,34,35)/t16-,17?/m0/s1 |
| InChIKey | SMLPZVNZCNBGBA-BHWOMJMDSA-N |
| XLogP | 7.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.09 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|