C23H13BrCl3F4N3O2 — CID 134417974
N-(3-amino-2,4-difluorophenyl)-5-[[3-(3-bromo-4,5-difluorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide (PubChem CID 134417974) has the molecular formula C23H13BrCl3F4N3O2 and a molecular weight of 625.63 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-5-[[3-(3-bromo-4,5-difluorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-5-[[3-(3-bromo-4,5-difluorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 134417974 |
| Molecular Formula | C23H13BrCl3F4N3O2 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 622.92 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-5-[[3-(3-bromo-4,5-difluorophenyl)-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2cc(NC(=O)C3C(c4cc(F)c(F)c(Br)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C23H13BrCl3F4N3O2/c24-11-5-8(6-14(29)18(11)30)16-17(23(16,26)27)22(36)33-9-1-2-12(25)10(7-9)21(35)34-15-4-3-13(28)20(32)19(15)31/h1-7,16-17H,32H2,(H,33,36)(H,34,35) |
| InChIKey | MFIQWDKUNWXLJO-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|