C23H15Cl4F2N3O2 — CID 134418271
N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(4-chlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 134418271) has the molecular formula C23H15Cl4F2N3O2 and a molecular weight of 545.20 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(4-chlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(4-chlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 134418271 |
| Molecular Formula | C23H15Cl4F2N3O2 |
| Molecular Weight | 545.20 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(4-chlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2cc(NC(=O)C3C(c4ccc(Cl)cc4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C23H15Cl4F2N3O2/c24-11-3-1-10(2-4-11)17-18(23(17,26)27)22(34)31-12-5-6-14(25)13(9-12)21(33)32-16-8-7-15(28)20(30)19(16)29/h1-9,17-18H,30H2,(H,31,34)(H,32,33) |
| InChIKey | KUUYFSPCIWRVTL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.20 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|