C23H14BrCl3F7N3O2S — CID 140859579
N-(3-amino-2,4-difluorophenyl)-5-[[(1R,3S)-3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide (PubChem CID 140859579) has the molecular formula C23H14BrCl3F7N3O2S and a molecular weight of 715.70 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-5-[[(1R,3S)-3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-5-[[(1R,3S)-3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 140859579 |
| Molecular Formula | C23H14BrCl3F7N3O2S |
| Molecular Weight | 715.70 g/mol |
| Exact Mass | 712.89 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-5-[[(1R,3S)-3-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chlorobenzamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2cc(NC(=O)[C@H]3[C@@H](c4cc(Br)cc(S(F)(F)(F)(F)F)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C23H14BrCl3F7N3O2S/c24-10-5-9(6-12(7-10)40(30,31,32,33)34)17-18(23(17,26)27)22(39)36-11-1-2-14(25)13(8-11)21(38)37-16-4-3-15(28)20(35)19(16)29/h1-8,17-18H,35H2,(H,36,39)(H,37,38)/t17-,18-/m1/s1 |
| InChIKey | USBHUTFTAVRFAY-QZTJIDSGSA-N |
| XLogP | 9.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.70 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|