C24H16Cl3F7N2O2S — CID 153033847
N-[3-[2-(3-amino-2,4-difluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 153033847) has the molecular formula C24H16Cl3F7N2O2S and a molecular weight of 635.82 g/mol. Its IUPAC name is N-[3-[2-(3-amino-2,4-difluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-[3-[2-(3-amino-2,4-difluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 153033847 |
| Molecular Formula | C24H16Cl3F7N2O2S |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 633.99 |
| IUPAC Name | N-[3-[2-(3-amino-2,4-difluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | Nc1c(F)ccc(CC(=O)c2cc(NC(=O)C3C(c4ccc(S(F)(F)(F)(F)F)cc4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C24H16Cl3F7N2O2S/c25-16-7-4-13(10-15(16)18(37)9-12-3-8-17(28)22(35)21(12)29)36-23(38)20-19(24(20,26)27)11-1-5-14(6-2-11)39(30,31,32,33)34/h1-8,10,19-20H,9,35H2,(H,36,38) |
| InChIKey | VEIHMDOJEITAQD-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|