C24H16Cl5FN2O2 — CID 149208417
trans-(1R,3R)-N-[3-[2-(2-amino-4-fluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 149208417) has the molecular formula C24H16Cl5FN2O2 and a molecular weight of 560.67 g/mol. Its IUPAC name is trans-(1R,3R)-N-[3-[2-(2-amino-4-fluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-N-[3-[2-(2-amino-4-fluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 149208417 |
| Molecular Formula | C24H16Cl5FN2O2 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | trans-(1R,3R)-N-[3-[2-(2-amino-4-fluorophenyl)acetyl]-4-chlorophenyl]-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Nc1cc(F)ccc1CC(=O)c1cc(NC(=O)[C@H]2[C@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H16Cl5FN2O2/c25-16-6-4-14(10-15(16)20(33)8-11-1-3-13(30)9-19(11)31)32-23(34)22-21(24(22,28)29)12-2-5-17(26)18(27)7-12/h1-7,9-10,21-22H,8,31H2,(H,32,34)/t21-,22+/m0/s1 |
| InChIKey | XGBZCSSTAVLYLZ-FCHUYYIVSA-N |
| XLogP | 7.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|