C23H14Cl5FN2O2 — CID 122618432
2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3-fluorophenyl)benzamide (PubChem CID 122618432) has the molecular formula C23H14Cl5FN2O2 and a molecular weight of 546.64 g/mol. Its IUPAC name is 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3-fluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 122618432 |
| Molecular Formula | C23H14Cl5FN2O2 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 543.95 |
| IUPAC Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(NC(=O)[C@@H]2[C@@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H14Cl5FN2O2/c24-16-7-5-14(10-15(16)21(32)30-13-3-1-2-12(29)9-13)31-22(33)20-19(23(20,27)28)11-4-6-17(25)18(26)8-11/h1-10,19-20H,(H,30,32)(H,31,33)/t19-,20+/m1/s1 |
| InChIKey | WQLVMUUXEPQIBV-UXHICEINSA-N |
| XLogP | 7.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|