C24H13Cl5F3NO2 — CID 148562302
2,2-dichloro-N-[4-chloro-3-[2-(2,3,4-trifluorophenyl)acetyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 148562302) has the molecular formula C24H13Cl5F3NO2 and a molecular weight of 581.63 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[2-(2,3,4-trifluorophenyl)acetyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[2-(2,3,4-trifluorophenyl)acetyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 148562302 |
| Molecular Formula | C24H13Cl5F3NO2 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 578.93 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[2-(2,3,4-trifluorophenyl)acetyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1F)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H13Cl5F3NO2/c25-12-5-11(6-13(26)8-12)19-20(24(19,28)29)23(35)33-14-2-3-16(27)15(9-14)18(34)7-10-1-4-17(30)22(32)21(10)31/h1-6,8-9,19-20H,7H2,(H,33,35) |
| InChIKey | MVFQJPCQZQUZSY-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|