C24H18Cl6N2O2 — CID 158483690
[4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl]azanium chloride (PubChem CID 158483690) has the molecular formula C24H18Cl6N2O2 and a molecular weight of 579.14 g/mol. Its IUPAC name is [4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl]azanium chloride.
| Compound Name | [4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl]azanium chloride |
|---|---|
| PubChem CID | 158483690 |
| Molecular Formula | C24H18Cl6N2O2 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 575.95 |
| IUPAC Name | [4-[2-[2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]phenyl]-2-oxoethyl]phenyl]azanium chloride |
| SMILES | [Cl-].[NH3+]c1ccc(CC(=O)c2cc(NC(=O)C3C(c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H17Cl5N2O2.ClH/c25-14-8-13(9-15(26)10-14)21-22(24(21,28)29)23(33)31-17-5-6-19(27)18(11-17)20(32)7-12-1-3-16(30)4-2-12;/h1-6,8-11,21-22H,7,30H2,(H,31,33);1H |
| InChIKey | BBJIQIZPHGOLJH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|