C25H16Cl4FNO3 — CID 160756230
2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(4-fluorophenyl)acetyl]-4-formylphenyl]cyclopropane-1-carboxamide (PubChem CID 160756230) has the molecular formula C25H16Cl4FNO3 and a molecular weight of 539.22 g/mol. Its IUPAC name is 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(4-fluorophenyl)acetyl]-4-formylphenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(4-fluorophenyl)acetyl]-4-formylphenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 160756230 |
| Molecular Formula | C25H16Cl4FNO3 |
| Molecular Weight | 539.22 g/mol |
| Exact Mass | 536.99 |
| IUPAC Name | 2,2-dichloro-3-(3,5-dichlorophenyl)-N-[3-[2-(4-fluorophenyl)acetyl]-4-formylphenyl]cyclopropane-1-carboxamide |
| SMILES | O=Cc1ccc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)cc1C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H16Cl4FNO3/c26-16-8-15(9-17(27)10-16)22-23(25(22,28)29)24(34)31-19-6-3-14(12-32)20(11-19)21(33)7-13-1-4-18(30)5-2-13/h1-6,8-12,22-23H,7H2,(H,31,34) |
| InChIKey | RXLXAPCWWDJEIK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.22 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|