C24H17Cl4FN2O3S — CID 122617918
5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfinylbenzamide (PubChem CID 122617918) has the molecular formula C24H17Cl4FN2O3S and a molecular weight of 574.29 g/mol. Its IUPAC name is 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfinylbenzamide.
| Compound Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfinylbenzamide |
|---|---|
| PubChem CID | 122617918 |
| Molecular Formula | C24H17Cl4FN2O3S |
| Molecular Weight | 574.29 g/mol |
| Exact Mass | 571.97 |
| IUPAC Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)-2-methylsulfinylbenzamide |
| SMILES | CS(=O)c1ccc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)cc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17Cl4FN2O3S/c1-35(34)19-7-6-17(11-18(19)22(32)30-16-4-2-15(29)3-5-16)31-23(33)21-20(24(21,27)28)12-8-13(25)10-14(26)9-12/h2-11,20-21H,1H3,(H,30,32)(H,31,33) |
| InChIKey | GLUUMNOWCQBYAP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.29 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|