C23H14Cl4F2N2O2 — CID 122619150
2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)-2-fluorocyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide (PubChem CID 122619150) has the molecular formula C23H14Cl4F2N2O2 and a molecular weight of 530.19 g/mol. Its IUPAC name is 2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)-2-fluorocyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)-2-fluorocyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 122619150 |
| Molecular Formula | C23H14Cl4F2N2O2 |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)-2-fluorocyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(F)Cl)ccc1Cl |
| InChI | InChI=1S/C23H14Cl4F2N2O2/c24-12-7-11(8-13(25)9-12)19-20(23(19,27)29)22(33)31-16-5-6-18(26)17(10-16)21(32)30-15-3-1-14(28)2-4-15/h1-10,19-20H,(H,30,32)(H,31,33) |
| InChIKey | MZRYRVQQPKDBFI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|