C23H15Cl4FN2O2 — CID 138653272
2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide (PubChem CID 138653272) has the molecular formula C23H15Cl4FN2O2 and a molecular weight of 512.20 g/mol. Its IUPAC name is 2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 138653272 |
| Molecular Formula | C23H15Cl4FN2O2 |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 2-chloro-5-[[2-chloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(NC(=O)C2C(Cl)C2c2cc(Cl)cc(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C23H15Cl4FN2O2/c24-12-7-11(8-13(25)9-12)19-20(21(19)27)23(32)30-16-5-6-18(26)17(10-16)22(31)29-15-3-1-14(28)2-4-15/h1-10,19-21H,(H,29,31)(H,30,32) |
| InChIKey | LCOWXMAMGHMVPF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|