C23H14Cl6N2O2 — CID 122619017
2-chloro-N-(4-chlorophenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122619017) has the molecular formula C23H14Cl6N2O2 and a molecular weight of 563.10 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122619017 |
| Molecular Formula | C23H14Cl6N2O2 |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H14Cl6N2O2/c24-12-1-3-15(4-2-12)30-21(32)17-10-16(5-6-18(17)27)31-22(33)20-19(23(20,28)29)11-7-13(25)9-14(26)8-11/h1-10,19-20H,(H,30,32)(H,31,33) |
| InChIKey | PXRBBUNTENLZCZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|