C25H20Cl5N3O2 — CID 122617818
2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(dimethylamino)phenyl]benzamide (PubChem CID 122617818) has the molecular formula C25H20Cl5N3O2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(dimethylamino)phenyl]benzamide.
| Compound Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(dimethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 122617818 |
| Molecular Formula | C25H20Cl5N3O2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 569.00 |
| IUPAC Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(dimethylamino)phenyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(NC(=O)[C@@H]3[C@@H](c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H20Cl5N3O2/c1-33(2)18-6-3-16(4-7-18)31-23(34)19-12-17(5-8-20(19)28)32-24(35)22-21(25(22,29)30)13-9-14(26)11-15(27)10-13/h3-12,21-22H,1-2H3,(H,31,34)(H,32,35)/t21-,22+/m1/s1 |
| InChIKey | INMFFJDUOQJPEC-YADHBBJMSA-N |
| XLogP | 7.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|