C20H13Cl5F3N3O3 — CID 134418022
2,2-dichloro-N-[4-chloro-3-[[methyl-(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 134418022) has the molecular formula C20H13Cl5F3N3O3 and a molecular weight of 577.60 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[[methyl-(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[[methyl-(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134418022 |
| Molecular Formula | C20H13Cl5F3N3O3 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 574.94 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[[methyl-(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CN(NC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H13Cl5F3N3O3/c1-31(18(34)20(26,27)28)30-16(32)12-7-11(2-3-13(12)23)29-17(33)15-14(19(15,24)25)8-4-9(21)6-10(22)5-8/h2-7,14-15H,1H3,(H,29,33)(H,30,32) |
| InChIKey | VSMYXXCOHUAZFI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|